C19H23ClN4O2 — CID 155494026
(3S,7R,8aS)-3-(4-chlorophenyl)-N-(4-ethoxypyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine (PubChem CID 155494026) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is (3S,7R,8aS)-3-(4-chlorophenyl)-N-(4-ethoxypyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine.
| Compound Name | (3S,7R,8aS)-3-(4-chlorophenyl)-N-(4-ethoxypyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 155494026 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (3S,7R,8aS)-3-(4-chlorophenyl)-N-(4-ethoxypyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
| SMILES | CCOc1ccnc(N[C@@H]2C[C@H]3CO[C@@H](c4ccc(Cl)cc4)CN3C2)n1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-2-25-18-7-8-21-19(23-18)22-15-9-16-12-26-17(11-24(16)10-15)13-3-5-14(20)6-4-13/h3-8,15-17H,2,9-12H2,1H3,(H,21,22,23)/t15-,16+,17-/m1/s1 |
| InChIKey | RRGLTMCWDHXUBP-IXDOHACOSA-N |
| XLogP | 3.15 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |