C21H26N6O2 — CID 155498603
(4aR,6S,8aR)-6-[2-(2-methoxyphenyl)-5-(5-methyl-1H-pyrazol-4-yl)-1,2,4-triazol-3-yl]-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine (PubChem CID 155498603) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is (4aR,6S,8aR)-6-[2-(2-methoxyphenyl)-5-(5-methyl-1H-pyrazol-4-yl)-1,2,4-triazol-3-yl]-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine.
| Compound Name | (4aR,6S,8aR)-6-[2-(2-methoxyphenyl)-5-(5-methyl-1H-pyrazol-4-yl)-1,2,4-triazol-3-yl]-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 155498603 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (4aR,6S,8aR)-6-[2-(2-methoxyphenyl)-5-(5-methyl-1H-pyrazol-4-yl)-1,2,4-triazol-3-yl]-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
| SMILES | COc1ccccc1-n1nc(-c2cn[nH]c2C)nc1[C@H]1CC[C@H]2OCCN[C@@H]2C1 |
| InChI | InChI=1S/C21H26N6O2/c1-13-15(12-23-25-13)20-24-21(14-7-8-18-16(11-14)22-9-10-29-18)27(26-20)17-5-3-4-6-19(17)28-2/h3-6,12,14,16,18,22H,7-11H2,1-2H3,(H,23,25)/t14-,16+,18+/m0/s1 |
| InChIKey | JHPZJPXYLDKRMB-YXJHDRRASA-N |
| XLogP | 2.60 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |