C23H29N3O4 — CID 155499021
N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-6-(4-methoxyphenyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 155499021) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-6-(4-methoxyphenyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-6-(4-methoxyphenyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155499021 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-6-(4-methoxyphenyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)N[C@H]3C[C@H]4CO[C@@H](C(C)C)CN4C3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-14(2)21-12-26-11-16(10-17(26)13-30-21)24-22(27)19-8-9-20(25-23(19)28)15-4-6-18(29-3)7-5-15/h4-9,14,16-17,21H,10-13H2,1-3H3,(H,24,27)(H,25,28)/t16-,17-,21+/m0/s1 |
| InChIKey | RLQZWKMUABRBKP-XGHQBKJUSA-N |
| XLogP | 2.28 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |