C19H25N7 — CID 155499928
2-(5-pentyl-2-pyridin-2-yl-1,2,4-triazol-3-yl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine (PubChem CID 155499928) has the molecular formula C19H25N7 and a molecular weight of 351.46 g/mol. Its IUPAC name is 2-(5-pentyl-2-pyridin-2-yl-1,2,4-triazol-3-yl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine.
| Compound Name | 2-(5-pentyl-2-pyridin-2-yl-1,2,4-triazol-3-yl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine |
|---|---|
| PubChem CID | 155499928 |
| Molecular Formula | C19H25N7 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-(5-pentyl-2-pyridin-2-yl-1,2,4-triazol-3-yl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine |
| SMILES | CCCCCc1nc(-c2cn3c(n2)CCNCC3)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C19H25N7/c1-2-3-4-7-16-23-19(26(24-16)17-8-5-6-10-21-17)15-14-25-13-12-20-11-9-18(25)22-15/h5-6,8,10,14,20H,2-4,7,9,11-13H2,1H3 |
| InChIKey | MFYOQEJMRLJGHI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|