C15H20N6 — CID 138377854
1-(2-methylpyrazol-3-yl)-3-pentyl-5-(1H-pyrrol-2-yl)-1,2,4-triazole (PubChem CID 138377854) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 1-(2-methylpyrazol-3-yl)-3-pentyl-5-(1H-pyrrol-2-yl)-1,2,4-triazole.
| Compound Name | 1-(2-methylpyrazol-3-yl)-3-pentyl-5-(1H-pyrrol-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 138377854 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 1-(2-methylpyrazol-3-yl)-3-pentyl-5-(1H-pyrrol-2-yl)-1,2,4-triazole |
| SMILES | CCCCCc1nc(-c2ccc[nH]2)n(-c2ccnn2C)n1 |
| InChI | InChI=1S/C15H20N6/c1-3-4-5-8-13-18-15(12-7-6-10-16-12)21(19-13)14-9-11-17-20(14)2/h6-7,9-11,16H,3-5,8H2,1-2H3 |
| InChIKey | NBPJACCPQOILBB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|