C20H27N5O2 — CID 138385787
5-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpyrazol-3-yl)-3-pentyl-1,2,4-triazole (PubChem CID 138385787) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpyrazol-3-yl)-3-pentyl-1,2,4-triazole.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpyrazol-3-yl)-3-pentyl-1,2,4-triazole |
|---|---|
| PubChem CID | 138385787 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methyl]-1-(2-methylpyrazol-3-yl)-3-pentyl-1,2,4-triazole |
| SMILES | CCCCCc1nc(Cc2ccc(OC)c(OC)c2)n(-c2ccnn2C)n1 |
| InChI | InChI=1S/C20H27N5O2/c1-5-6-7-8-18-22-19(25(23-18)20-11-12-21-24(20)2)14-15-9-10-16(26-3)17(13-15)27-4/h9-13H,5-8,14H2,1-4H3 |
| InChIKey | ZZVNMBLSUZYICT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|