C11H19NO4 — CID 155501808
(3R,3aR,6R,6aR)-3-(oxan-4-ylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 155501808) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-3-(oxan-4-ylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3R,3aR,6R,6aR)-3-(oxan-4-ylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 155501808 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (3R,3aR,6R,6aR)-3-(oxan-4-ylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2NC1CCOCC1 |
| InChI | InChI=1S/C11H19NO4/c13-9-6-16-10-8(5-15-11(9)10)12-7-1-3-14-4-2-7/h7-13H,1-6H2/t8-,9-,10-,11-/m1/s1 |
| InChIKey | SMPSDTZTJUSDKY-GWOFURMSSA-N |
| XLogP | -0.72 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |