C17H29N3O3 — CID 155503908
(3S,4R)-3-(hydroxymethyl)-3-(3-methoxypropyl)-1-(5-propylpyrimidin-2-yl)piperidin-4-ol (PubChem CID 155503908) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is (3S,4R)-3-(hydroxymethyl)-3-(3-methoxypropyl)-1-(5-propylpyrimidin-2-yl)piperidin-4-ol.
| Compound Name | (3S,4R)-3-(hydroxymethyl)-3-(3-methoxypropyl)-1-(5-propylpyrimidin-2-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 155503908 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (3S,4R)-3-(hydroxymethyl)-3-(3-methoxypropyl)-1-(5-propylpyrimidin-2-yl)piperidin-4-ol |
| SMILES | CCCc1cnc(N2CC[C@@H](O)[C@@](CO)(CCCOC)C2)nc1 |
| InChI | InChI=1S/C17H29N3O3/c1-3-5-14-10-18-16(19-11-14)20-8-6-15(22)17(12-20,13-21)7-4-9-23-2/h10-11,15,21-22H,3-9,12-13H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | ZKJYFSFUXDTBMY-WBVHZDCISA-N |
| XLogP | 1.41 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|