C15H20F3N3O2 — CID 155509982
[(4aS,6R)-4-[[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol (PubChem CID 155509982) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is [(4aS,6R)-4-[[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol.
| Compound Name | [(4aS,6R)-4-[[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol |
|---|---|
| PubChem CID | 155509982 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | [(4aS,6R)-4-[[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol |
| SMILES | Cc1nc(C(F)(F)F)ncc1CN1CCOC2C[C@H](CO)C[C@@H]21 |
| InChI | InChI=1S/C15H20F3N3O2/c1-9-11(6-19-14(20-9)15(16,17)18)7-21-2-3-23-13-5-10(8-22)4-12(13)21/h6,10,12-13,22H,2-5,7-8H2,1H3/t10-,12+,13?/m1/s1 |
| InChIKey | LWNMUPWJPCEJSY-FVBASEICSA-N |
| XLogP | 1.78 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |