C19H20N2O5Se — CID 155512471
5-(3,4-dimethoxy-5-methylselanylphenyl)-9-hydroxy-8-methoxy-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 155512471) has the molecular formula C19H20N2O5Se and a molecular weight of 435.34 g/mol. Its IUPAC name is 5-(3,4-dimethoxy-5-methylselanylphenyl)-9-hydroxy-8-methoxy-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 5-(3,4-dimethoxy-5-methylselanylphenyl)-9-hydroxy-8-methoxy-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 155512471 |
| Molecular Formula | C19H20N2O5Se |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 5-(3,4-dimethoxy-5-methylselanylphenyl)-9-hydroxy-8-methoxy-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | COc1ccc2c(c1O)NC(=O)CN=C2c1cc(OC)c(OC)c([Se]C)c1 |
| InChI | InChI=1S/C19H20N2O5Se/c1-24-12-6-5-11-16(20-9-15(22)21-17(11)18(12)23)10-7-13(25-2)19(26-3)14(8-10)27-4/h5-8,23H,9H2,1-4H3,(H,21,22) |
| InChIKey | RHHZTPXSACARDB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|