C20H23NO5Se — CID 172750266
(3R,4R)-1-(3,4-dimethoxy-5-methylselanylphenyl)-4-(3-hydroxy-4-methoxyphenyl)-3-methylazetidin-2-one (PubChem CID 172750266) has the molecular formula C20H23NO5Se and a molecular weight of 436.37 g/mol. Its IUPAC name is (3R,4R)-1-(3,4-dimethoxy-5-methylselanylphenyl)-4-(3-hydroxy-4-methoxyphenyl)-3-methylazetidin-2-one.
| Compound Name | (3R,4R)-1-(3,4-dimethoxy-5-methylselanylphenyl)-4-(3-hydroxy-4-methoxyphenyl)-3-methylazetidin-2-one |
|---|---|
| PubChem CID | 172750266 |
| Molecular Formula | C20H23NO5Se |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | (3R,4R)-1-(3,4-dimethoxy-5-methylselanylphenyl)-4-(3-hydroxy-4-methoxyphenyl)-3-methylazetidin-2-one |
| SMILES | COc1ccc([C@H]2[C@@H](C)C(=O)N2c2cc(OC)c(OC)c([Se]C)c2)cc1O |
| InChI | InChI=1S/C20H23NO5Se/c1-11-18(12-6-7-15(24-2)14(22)8-12)21(20(11)23)13-9-16(25-3)19(26-4)17(10-13)27-5/h6-11,18,22H,1-5H3/t11-,18-/m1/s1 |
| InChIKey | KGTNYXCOAIBYCY-ADLMAVQZSA-N |
| XLogP | 2.52 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|