C21H15F3N4O2 — CID 155513195
2-[[1-[[4-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methylamino]naphthalene-1,4-dione (PubChem CID 155513195) has the molecular formula C21H15F3N4O2 and a molecular weight of 412.37 g/mol. Its IUPAC name is 2-[[1-[[4-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methylamino]naphthalene-1,4-dione.
| Compound Name | 2-[[1-[[4-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 155513195 |
| Molecular Formula | C21H15F3N4O2 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-[[1-[[4-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methylamino]naphthalene-1,4-dione |
| SMILES | O=C1C=C(NCc2cn(Cc3ccc(C(F)(F)F)cc3)nn2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H15F3N4O2/c22-21(23,24)14-7-5-13(6-8-14)11-28-12-15(26-27-28)10-25-18-9-19(29)16-3-1-2-4-17(16)20(18)30/h1-9,12,25H,10-11H2 |
| InChIKey | NVDZZWBJVQLXAU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|