C24H31ClN2O5 — CID 155515673
(E)-N-[3-(piperidin-4-ylmethoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride (PubChem CID 155515673) has the molecular formula C24H31ClN2O5 and a molecular weight of 462.97 g/mol. Its IUPAC name is (E)-N-[3-(piperidin-4-ylmethoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride.
| Compound Name | (E)-N-[3-(piperidin-4-ylmethoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 155515673 |
| Molecular Formula | C24H31ClN2O5 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (E)-N-[3-(piperidin-4-ylmethoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide;hydrochloride |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(OCC3CCNCC3)c2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C24H30N2O5.ClH/c1-28-21-13-18(14-22(29-2)24(21)30-3)7-8-23(27)26-19-5-4-6-20(15-19)31-16-17-9-11-25-12-10-17;/h4-8,13-15,17,25H,9-12,16H2,1-3H3,(H,26,27);1H/b8-7+; |
| InChIKey | XGUCNWPOKBWOJB-USRGLUTNSA-N |
| XLogP | 4.16 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|