C19H15N5O2S — CID 155515784
N-methyl-4-[4-(4-thiophen-2-yltriazol-1-yl)phenoxy]pyridine-2-carboxamide (PubChem CID 155515784) has the molecular formula C19H15N5O2S and a molecular weight of 377.43 g/mol. Its IUPAC name is N-methyl-4-[4-(4-thiophen-2-yltriazol-1-yl)phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[4-(4-thiophen-2-yltriazol-1-yl)phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155515784 |
| Molecular Formula | C19H15N5O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-methyl-4-[4-(4-thiophen-2-yltriazol-1-yl)phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(-n3cc(-c4cccs4)nn3)cc2)ccn1 |
| InChI | InChI=1S/C19H15N5O2S/c1-20-19(25)16-11-15(8-9-21-16)26-14-6-4-13(5-7-14)24-12-17(22-23-24)18-3-2-10-27-18/h2-12H,1H3,(H,20,25) |
| InChIKey | YAAPKIXNLLDELD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |