C19H20N4O2S — CID 155522629
7-methoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]quinoline-3-carboxamide (PubChem CID 155522629) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 7-methoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]quinoline-3-carboxamide.
| Compound Name | 7-methoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 155522629 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 7-methoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]quinoline-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NC3CCN(c4nccs4)CC3)cnc2c1 |
| InChI | InChI=1S/C19H20N4O2S/c1-25-16-3-2-13-10-14(12-21-17(13)11-16)18(24)22-15-4-7-23(8-5-15)19-20-6-9-26-19/h2-3,6,9-12,15H,4-5,7-8H2,1H3,(H,22,24) |
| InChIKey | YWXDWYPKMQNOPP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |