C24H24N2O2 — CID 155523141
1-[4-[(2R)-1-aminopropan-2-yl]phenyl]-2-hydroxy-4,9-dimethyl-5H-phenanthridin-6-one (PubChem CID 155523141) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[4-[(2R)-1-aminopropan-2-yl]phenyl]-2-hydroxy-4,9-dimethyl-5H-phenanthridin-6-one.
| Compound Name | 1-[4-[(2R)-1-aminopropan-2-yl]phenyl]-2-hydroxy-4,9-dimethyl-5H-phenanthridin-6-one |
|---|---|
| PubChem CID | 155523141 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[4-[(2R)-1-aminopropan-2-yl]phenyl]-2-hydroxy-4,9-dimethyl-5H-phenanthridin-6-one |
| SMILES | Cc1ccc2c(=O)[nH]c3c(C)cc(O)c(-c4ccc([C@@H](C)CN)cc4)c3c2c1 |
| InChI | InChI=1S/C24H24N2O2/c1-13-4-9-18-19(10-13)22-21(17-7-5-16(6-8-17)15(3)12-25)20(27)11-14(2)23(22)26-24(18)28/h4-11,15,27H,12,25H2,1-3H3,(H,26,28)/t15-/m0/s1 |
| InChIKey | RABYQTQIXKIMHR-HNNXBMFYSA-N |
| XLogP | 4.73 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|