C16H13F3N4O4 — CID 155523445
5,6-dimethyl-2-nitro-7-[[2-(trifluoromethoxy)phenyl]methyl]imidazo[1,2-a]pyrazin-8-one (PubChem CID 155523445) has the molecular formula C16H13F3N4O4 and a molecular weight of 382.30 g/mol. Its IUPAC name is 5,6-dimethyl-2-nitro-7-[[2-(trifluoromethoxy)phenyl]methyl]imidazo[1,2-a]pyrazin-8-one.
| Compound Name | 5,6-dimethyl-2-nitro-7-[[2-(trifluoromethoxy)phenyl]methyl]imidazo[1,2-a]pyrazin-8-one |
|---|---|
| PubChem CID | 155523445 |
| Molecular Formula | C16H13F3N4O4 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 5,6-dimethyl-2-nitro-7-[[2-(trifluoromethoxy)phenyl]methyl]imidazo[1,2-a]pyrazin-8-one |
| SMILES | Cc1c(C)n2cc([N+](=O)[O-])nc2c(=O)n1Cc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H13F3N4O4/c1-9-10(2)22(15(24)14-20-13(23(25)26)8-21(9)14)7-11-5-3-4-6-12(11)27-16(17,18)19/h3-6,8H,7H2,1-2H3 |
| InChIKey | YYLCMDKXRBNXON-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|