C23H22N2O4S2 — CID 155526589
ethyl 2-[[1-[(4-methylphenyl)sulfonylamino]-9H-carbazol-3-yl]sulfanyl]acetate (PubChem CID 155526589) has the molecular formula C23H22N2O4S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is ethyl 2-[[1-[(4-methylphenyl)sulfonylamino]-9H-carbazol-3-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[1-[(4-methylphenyl)sulfonylamino]-9H-carbazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 155526589 |
| Molecular Formula | C23H22N2O4S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | ethyl 2-[[1-[(4-methylphenyl)sulfonylamino]-9H-carbazol-3-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1cc(NS(=O)(=O)c2ccc(C)cc2)c2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C23H22N2O4S2/c1-3-29-22(26)14-30-16-12-19-18-6-4-5-7-20(18)24-23(19)21(13-16)25-31(27,28)17-10-8-15(2)9-11-17/h4-13,24-25H,3,14H2,1-2H3 |
| InChIKey | WJJBUIUNBUPAJN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |