C19H22F3N3OS — CID 155526665
(3R,4R)-N-[[4-(dimethylamino)phenyl]methyl]-4-[5-(trifluoromethyl)thiophen-2-yl]pyrrolidine-3-carboxamide (PubChem CID 155526665) has the molecular formula C19H22F3N3OS and a molecular weight of 397.47 g/mol. Its IUPAC name is (3R,4R)-N-[[4-(dimethylamino)phenyl]methyl]-4-[5-(trifluoromethyl)thiophen-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-[[4-(dimethylamino)phenyl]methyl]-4-[5-(trifluoromethyl)thiophen-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155526665 |
| Molecular Formula | C19H22F3N3OS |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (3R,4R)-N-[[4-(dimethylamino)phenyl]methyl]-4-[5-(trifluoromethyl)thiophen-2-yl]pyrrolidine-3-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)[C@H]2CNC[C@@H]2c2ccc(C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C19H22F3N3OS/c1-25(2)13-5-3-12(4-6-13)9-24-18(26)15-11-23-10-14(15)16-7-8-17(27-16)19(20,21)22/h3-8,14-15,23H,9-11H2,1-2H3,(H,24,26)/t14-,15-/m0/s1 |
| InChIKey | RSHXYWMXLKRKRS-GJZGRUSLSA-N |
| XLogP | 3.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|