C31H30F3N7O4Se — CID 155528874
N-[6-[4-[5-[[2-(5-methoxy-1-methylindol-3-yl)acetyl]amino]-1,3,4-selenadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 155528874) has the molecular formula C31H30F3N7O4Se and a molecular weight of 700.58 g/mol. Its IUPAC name is N-[6-[4-[5-[[2-(5-methoxy-1-methylindol-3-yl)acetyl]amino]-1,3,4-selenadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[6-[4-[5-[[2-(5-methoxy-1-methylindol-3-yl)acetyl]amino]-1,3,4-selenadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 155528874 |
| Molecular Formula | C31H30F3N7O4Se |
| Molecular Weight | 700.58 g/mol |
| Exact Mass | 701.15 |
| IUPAC Name | N-[6-[4-[5-[[2-(5-methoxy-1-methylindol-3-yl)acetyl]amino]-1,3,4-selenadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(=O)Nc1nnc(CCCCc3ccc(NC(=O)Cc4cccc(OC(F)(F)F)c4)nn3)[se]1)cn2C |
| InChI | InChI=1S/C31H30F3N7O4Se/c1-41-18-20(24-17-22(44-2)11-12-25(24)41)16-28(43)36-30-40-39-29(46-30)9-4-3-7-21-10-13-26(38-37-21)35-27(42)15-19-6-5-8-23(14-19)45-31(32,33)34/h5-6,8,10-14,17-18H,3-4,7,9,15-16H2,1-2H3,(H,35,38,42)(H,36,40,43) |
| InChIKey | MKBYKQXRYXKSPV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|