C12H11BrN4OS2 — CID 155534410
1-(4-bromophenyl)-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)urea (PubChem CID 155534410) has the molecular formula C12H11BrN4OS2 and a molecular weight of 371.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)urea.
| Compound Name | 1-(4-bromophenyl)-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)urea |
|---|---|
| PubChem CID | 155534410 |
| Molecular Formula | C12H11BrN4OS2 |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 1-(4-bromophenyl)-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)urea |
| SMILES | C=CCSc1nc(NC(=O)Nc2ccc(Br)cc2)ns1 |
| InChI | InChI=1S/C12H11BrN4OS2/c1-2-7-19-12-16-10(17-20-12)15-11(18)14-9-5-3-8(13)4-6-9/h2-6H,1,7H2,(H2,14,15,17,18) |
| InChIKey | RITLVPHXDNQCGQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|