C14H9BrF3NO6S — CID 155534418
3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-(trifluoromethoxy)benzoic acid (PubChem CID 155534418) has the molecular formula C14H9BrF3NO6S and a molecular weight of 456.19 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-(trifluoromethoxy)benzoic acid.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 155534418 |
| Molecular Formula | C14H9BrF3NO6S |
| Molecular Weight | 456.19 g/mol |
| Exact Mass | 454.93 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-(trifluoromethoxy)benzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2cc(Br)ccc2O)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H9BrF3NO6S/c15-8-1-2-11(20)12(5-8)26(23,24)19-9-3-7(13(21)22)4-10(6-9)25-14(16,17)18/h1-6,19-20H,(H,21,22) |
| InChIKey | PAORABHCETVZBY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |