C16H16N4O3S — CID 155534969
[4-[5-[(4-methylsulfonylphenyl)methyl]tetrazol-1-yl]phenyl]methanol (PubChem CID 155534969) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is [4-[5-[(4-methylsulfonylphenyl)methyl]tetrazol-1-yl]phenyl]methanol.
| Compound Name | [4-[5-[(4-methylsulfonylphenyl)methyl]tetrazol-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 155534969 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [4-[5-[(4-methylsulfonylphenyl)methyl]tetrazol-1-yl]phenyl]methanol |
| SMILES | CS(=O)(=O)c1ccc(Cc2nnnn2-c2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C16H16N4O3S/c1-24(22,23)15-8-4-12(5-9-15)10-16-17-18-19-20(16)14-6-2-13(11-21)3-7-14/h2-9,21H,10-11H2,1H3 |
| InChIKey | WTYAEYRSAHDFQD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |