C22H20FN5O — CID 155535039
2-[(3Z)-6-fluoro-3-[(4-propan-2-ylphenyl)methylidene]inden-1-yl]-N-(2H-tetrazol-5-yl)acetamide (PubChem CID 155535039) has the molecular formula C22H20FN5O and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-[(3Z)-6-fluoro-3-[(4-propan-2-ylphenyl)methylidene]inden-1-yl]-N-(2H-tetrazol-5-yl)acetamide.
| Compound Name | 2-[(3Z)-6-fluoro-3-[(4-propan-2-ylphenyl)methylidene]inden-1-yl]-N-(2H-tetrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 155535039 |
| Molecular Formula | C22H20FN5O |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[(3Z)-6-fluoro-3-[(4-propan-2-ylphenyl)methylidene]inden-1-yl]-N-(2H-tetrazol-5-yl)acetamide |
| SMILES | CC(C)c1ccc(/C=C2/C=C(CC(=O)Nc3nn[nH]n3)c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C22H20FN5O/c1-13(2)15-5-3-14(4-6-15)9-16-10-17(20-12-18(23)7-8-19(16)20)11-21(29)24-22-25-27-28-26-22/h3-10,12-13H,11H2,1-2H3,(H2,24,25,26,27,28,29)/b16-9- |
| InChIKey | OJVUGNRMPNICSM-SXGWCWSVSA-N |
| XLogP | 4.43 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|