C16H15N5O — CID 2166728
3,3-diphenyl-N-(2H-tetrazol-5-yl)propanamide (PubChem CID 2166728) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is 3,3-diphenyl-N-(2H-tetrazol-5-yl)propanamide.
| Compound Name | 3,3-diphenyl-N-(2H-tetrazol-5-yl)propanamide |
|---|---|
| PubChem CID | 2166728 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3,3-diphenyl-N-(2H-tetrazol-5-yl)propanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1nn[nH]n1 |
| InChI | InChI=1S/C16H15N5O/c22-15(17-16-18-20-21-19-16)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2,(H2,17,18,19,20,21,22) |
| InChIKey | YCVQVTALQCFVCU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |