C26H23N5S — CID 155535362
2-(1H-indol-3-yl)-N-[(E)-1-phenylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 155535362) has the molecular formula C26H23N5S and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[(E)-1-phenylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(1H-indol-3-yl)-N-[(E)-1-phenylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155535362 |
| Molecular Formula | C26H23N5S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[(E)-1-phenylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C/C(=N\Nc1nc(-c2c[nH]c3ccccc23)nc2sc3c(c12)CCCC3)c1ccccc1 |
| InChI | InChI=1S/C26H23N5S/c1-16(17-9-3-2-4-10-17)30-31-25-23-19-12-6-8-14-22(19)32-26(23)29-24(28-25)20-15-27-21-13-7-5-11-18(20)21/h2-5,7,9-11,13,15,27H,6,8,12,14H2,1H3,(H,28,29,31)/b30-16+ |
| InChIKey | DYVYXXUTHSOTBD-OKCVXOCRSA-N |
| XLogP | 6.55 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|