C19H14BrF2NO3 — CID 155535755
3-(4-bromophenyl)-1-[2-(2,4-difluorophenyl)-2-oxoethyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 155535755) has the molecular formula C19H14BrF2NO3 and a molecular weight of 422.23 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-[2-(2,4-difluorophenyl)-2-oxoethyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(4-bromophenyl)-1-[2-(2,4-difluorophenyl)-2-oxoethyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 155535755 |
| Molecular Formula | C19H14BrF2NO3 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 3-(4-bromophenyl)-1-[2-(2,4-difluorophenyl)-2-oxoethyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1(c2ccc(Br)cc2)CC(=O)N(CC(=O)c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C19H14BrF2NO3/c1-19(11-2-4-12(20)5-3-11)9-17(25)23(18(19)26)10-16(24)14-7-6-13(21)8-15(14)22/h2-8H,9-10H2,1H3 |
| InChIKey | YRPPQMKMQZIBLY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|