C29H35N3O3 — CID 155536912
1-butyl-3-[4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenyl]urea (PubChem CID 155536912) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is 1-butyl-3-[4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenyl]urea.
| Compound Name | 1-butyl-3-[4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenyl]urea |
|---|---|
| PubChem CID | 155536912 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 1-butyl-3-[4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenyl]phenyl]urea |
| SMILES | CCCCNC(=O)Nc1ccc(-c2ccc(CN3CCc4cc(OC)c(OC)cc4C3)cc2)cc1 |
| InChI | InChI=1S/C29H35N3O3/c1-4-5-15-30-29(33)31-26-12-10-23(11-13-26)22-8-6-21(7-9-22)19-32-16-14-24-17-27(34-2)28(35-3)18-25(24)20-32/h6-13,17-18H,4-5,14-16,19-20H2,1-3H3,(H2,30,31,33) |
| InChIKey | LXFYAANLQKZEQU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|