C25H27N7O4 — CID 155542658
N-hydroxy-2-[2-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxyethyl-propan-2-ylamino]pyrimidine-5-carboxamide (PubChem CID 155542658) has the molecular formula C25H27N7O4 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-hydroxy-2-[2-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxyethyl-propan-2-ylamino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[2-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxyethyl-propan-2-ylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155542658 |
| Molecular Formula | C25H27N7O4 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-hydroxy-2-[2-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxyethyl-propan-2-ylamino]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(-c2cc(OCCN(c3ncc(C(=O)NO)cn3)C(C)C)c3ncnc(C)c3c2)cn1 |
| InChI | InChI=1S/C25H27N7O4/c1-15(2)32(25-27-12-19(13-28-25)24(33)31-34)7-8-36-21-10-18(17-5-6-22(35-4)26-11-17)9-20-16(3)29-14-30-23(20)21/h5-6,9-15,34H,7-8H2,1-4H3,(H,31,33) |
| InChIKey | MKBSSERECOKTHX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|