C24H22ClN3O6S — CID 155543040
N-[(E)-(4-chloro-7-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-[(2,5-dimethoxyphenyl)sulfamoyl]benzamide (PubChem CID 155543040) has the molecular formula C24H22ClN3O6S and a molecular weight of 515.98 g/mol. Its IUPAC name is N-[(E)-(4-chloro-7-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-[(2,5-dimethoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(E)-(4-chloro-7-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-[(2,5-dimethoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 155543040 |
| Molecular Formula | C24H22ClN3O6S |
| Molecular Weight | 515.98 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | N-[(E)-(4-chloro-7-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-[(2,5-dimethoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2cccc(C(=O)N/N=C3\CCc4c(Cl)ccc(O)c43)c2)c1 |
| InChI | InChI=1S/C24H22ClN3O6S/c1-33-15-6-11-22(34-2)20(13-15)28-35(31,32)16-5-3-4-14(12-16)24(30)27-26-19-9-7-17-18(25)8-10-21(29)23(17)19/h3-6,8,10-13,28-29H,7,9H2,1-2H3,(H,27,30)/b26-19+ |
| InChIKey | CYHVYGKXJNPQSH-LGUFXXKBSA-N |
| XLogP | 3.94 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.98 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|