C24H23N3O6S — CID 155564275
4-[(2,5-dimethoxyphenyl)sulfamoyl]-N-[(E)-(7-hydroxy-2,3-dihydroinden-1-ylidene)amino]benzamide (PubChem CID 155564275) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)sulfamoyl]-N-[(E)-(7-hydroxy-2,3-dihydroinden-1-ylidene)amino]benzamide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)sulfamoyl]-N-[(E)-(7-hydroxy-2,3-dihydroinden-1-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 155564275 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)sulfamoyl]-N-[(E)-(7-hydroxy-2,3-dihydroinden-1-ylidene)amino]benzamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2ccc(C(=O)N/N=C3\CCc4cccc(O)c43)cc2)c1 |
| InChI | InChI=1S/C24H23N3O6S/c1-32-17-9-13-22(33-2)20(14-17)27-34(30,31)18-10-6-16(7-11-18)24(29)26-25-19-12-8-15-4-3-5-21(28)23(15)19/h3-7,9-11,13-14,27-28H,8,12H2,1-2H3,(H,26,29)/b25-19+ |
| InChIKey | QPTPVHGLUOIKMY-NCELDCMTSA-N |
| XLogP | 3.29 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|