C27H38INO2S — CID 155544066
methyl (1R,4aS,10aR)-6-(3-ethyl-2-methyl-1,3-thiazol-3-ium-4-yl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate iodide (PubChem CID 155544066) has the molecular formula C27H38INO2S and a molecular weight of 567.58 g/mol. Its IUPAC name is methyl (1R,4aS,10aR)-6-(3-ethyl-2-methyl-1,3-thiazol-3-ium-4-yl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate iodide.
| Compound Name | methyl (1R,4aS,10aR)-6-(3-ethyl-2-methyl-1,3-thiazol-3-ium-4-yl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate iodide |
|---|---|
| PubChem CID | 155544066 |
| Molecular Formula | C27H38INO2S |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | methyl (1R,4aS,10aR)-6-(3-ethyl-2-methyl-1,3-thiazol-3-ium-4-yl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate iodide |
| SMILES | CC[n+]1c(-c2cc3c(cc2C(C)C)CC[C@H]2[C@](C)(C(=O)OC)CCC[C@]32C)csc1C.[I-] |
| InChI | InChI=1S/C27H38NO2S.HI/c1-8-28-18(4)31-16-23(28)21-15-22-19(14-20(21)17(2)3)10-11-24-26(22,5)12-9-13-27(24,6)25(29)30-7;/h14-17,24H,8-13H2,1-7H3;1H/q+1;/p-1/t24-,26-,27-;/m1./s1 |
| InChIKey | DWSUSTSPXPUZHN-PWZZUJFHSA-M |
| XLogP | 3.34 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|