About S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate
S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate (PubChem CID 155544346) has the molecular formula C16H12O4S
and a molecular weight of 300.33 g/mol. Its IUPAC name is S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate.
Molecular Properties
| Compound Name | S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate |
| PubChem CID | 155544346 |
| Molecular Formula | C16H12O4S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate |
| SMILES | O=C(SCCc1ccco1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C16H12O4S/c17-15-13(10-11-4-1-2-6-14(11)20-15)16(18)21-9-7-12-5-3-8-19-12/h1-6,8,10H,7,9H2 |
| InChIKey | CTUKKXMFFDKESC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate?
The IUPAC name of S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate (CID 155544346) is S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate.
What is the SMILES notation for S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate?
The canonical SMILES for S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate is O=C(SCCc1ccco1)c1cc2ccccc2oc1=O.
What is the InChIKey of S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate?
The InChIKey is CTUKKXMFFDKESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O4S/c17-15-13(10-11-4-1-2-6-14(11)20-15)16(18)21-9-7-12-5-3-8-19-12/h1-6,8,10H,7,9H2.
What are the key properties of S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate?
S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate has a molecular weight of 300.33 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(furan-2-yl)ethyl] 2-oxochromene-3-carbothioate is sourced from PubChem (CID 155544346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).