C24H20O7S2 — CID 177065234
S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate (PubChem CID 177065234) has the molecular formula C24H20O7S2 and a molecular weight of 484.55 g/mol. Its IUPAC name is S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate.
| Compound Name | S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate |
|---|---|
| PubChem CID | 177065234 |
| Molecular Formula | C24H20O7S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate |
| SMILES | O=C(SCCOCCSC(=O)c1cc2ccccc2oc1=O)c1cc2c(oc1=O)=CCCC=2 |
| InChI | InChI=1S/C24H20O7S2/c25-21-17(13-15-5-1-3-7-19(15)30-21)23(27)32-11-9-29-10-12-33-24(28)18-14-16-6-2-4-8-20(16)31-22(18)26/h1,3,5-8,13-14H,2,4,9-12H2 |
| InChIKey | XZGWKVDOADHZOZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 103.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|