About S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate
S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate (PubChem CID 177065234) has the molecular formula C24H20O7S2
and a molecular weight of 484.55 g/mol. Its IUPAC name is S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate.
Molecular Properties
| Compound Name | S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate |
| PubChem CID | 177065234 |
| Molecular Formula | C24H20O7S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate |
| SMILES | O=C(SCCOCCSC(=O)c1cc2ccccc2oc1=O)c1cc2c(oc1=O)=CCCC=2 |
| InChI | InChI=1S/C24H20O7S2/c25-21-17(13-15-5-1-3-7-19(15)30-21)23(27)32-11-9-29-10-12-33-24(28)18-14-16-6-2-4-8-20(16)31-22(18)26/h1,3,5-8,13-14H,2,4,9-12H2 |
| InChIKey | XZGWKVDOADHZOZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 103.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate?
The IUPAC name of S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate (CID 177065234) is S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate.
What is the SMILES notation for S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate?
The canonical SMILES for S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate is O=C(SCCOCCSC(=O)c1cc2ccccc2oc1=O)c1cc2c(oc1=O)=CCCC=2.
What is the InChIKey of S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate?
The InChIKey is XZGWKVDOADHZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O7S2/c25-21-17(13-15-5-1-3-7-19(15)30-21)23(27)32-11-9-29-10-12-33-24(28)18-14-16-6-2-4-8-20(16)31-22(18)26/h1,3,5-8,13-14H,2,4,9-12H2.
What are the key properties of S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate?
S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate has a molecular weight of 484.55 g/mol, XLogP of 2.56, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[2-(2-oxo-6,7-dihydrochromene-3-carbonyl)sulfanylethoxy]ethyl] 2-oxochromene-3-carbothioate is sourced from PubChem (CID 177065234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).