C17H10F3N3O3 — CID 155550977
4-[5-(trifluoromethyl)-3-(2,3,4-trihydroxyphenyl)-1H-pyrazol-4-yl]benzonitrile (PubChem CID 155550977) has the molecular formula C17H10F3N3O3 and a molecular weight of 361.28 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)-3-(2,3,4-trihydroxyphenyl)-1H-pyrazol-4-yl]benzonitrile.
| Compound Name | 4-[5-(trifluoromethyl)-3-(2,3,4-trihydroxyphenyl)-1H-pyrazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 155550977 |
| Molecular Formula | C17H10F3N3O3 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-[5-(trifluoromethyl)-3-(2,3,4-trihydroxyphenyl)-1H-pyrazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c(-c3ccc(O)c(O)c3O)n[nH]c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F3N3O3/c18-17(19,20)16-12(9-3-1-8(7-21)2-4-9)13(22-23-16)10-5-6-11(24)15(26)14(10)25/h1-6,24-26H,(H,22,23) |
| InChIKey | GJXFIQIBGAJRMR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|