C13H7N3OS — CID 137255828
4-(5-hydroxy-2,1,3-benzothiadiazol-4-yl)benzonitrile (PubChem CID 137255828) has the molecular formula C13H7N3OS and a molecular weight of 253.29 g/mol. Its IUPAC name is 4-(5-hydroxy-2,1,3-benzothiadiazol-4-yl)benzonitrile.
| Compound Name | 4-(5-hydroxy-2,1,3-benzothiadiazol-4-yl)benzonitrile |
|---|---|
| PubChem CID | 137255828 |
| Molecular Formula | C13H7N3OS |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-(5-hydroxy-2,1,3-benzothiadiazol-4-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2c(O)ccc3nsnc23)cc1 |
| InChI | InChI=1S/C13H7N3OS/c14-7-8-1-3-9(4-2-8)12-11(17)6-5-10-13(12)16-18-15-10/h1-6,17H |
| InChIKey | CGXKTAHKYNEETL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |