C22H17BrN4O2 — CID 155554424
N-(4-bromophenyl)-1-cyano-2-[(4-hydroxyphenyl)methylideneamino]-6,7-dihydro-5H-pyrrolizine-3-carboxamide (PubChem CID 155554424) has the molecular formula C22H17BrN4O2 and a molecular weight of 449.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-cyano-2-[(4-hydroxyphenyl)methylideneamino]-6,7-dihydro-5H-pyrrolizine-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-cyano-2-[(4-hydroxyphenyl)methylideneamino]-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
|---|---|
| PubChem CID | 155554424 |
| Molecular Formula | C22H17BrN4O2 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | N-(4-bromophenyl)-1-cyano-2-[(4-hydroxyphenyl)methylideneamino]-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
| SMILES | N#Cc1c(/N=C/c2ccc(O)cc2)c(C(=O)Nc2ccc(Br)cc2)n2c1CCC2 |
| InChI | InChI=1S/C22H17BrN4O2/c23-15-5-7-16(8-6-15)26-22(29)21-20(18(12-24)19-2-1-11-27(19)21)25-13-14-3-9-17(28)10-4-14/h3-10,13,28H,1-2,11H2,(H,26,29)/b25-13+ |
| InChIKey | RUYOIFKVHOOUJH-DHRITJCHSA-N |
| XLogP | 4.78 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|