C19H19N5O3S — CID 5470028
2-[[(E)-but-2-enylidene]amino]-1-cyano-N-(4-sulfamoylphenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide (PubChem CID 5470028) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[[(E)-but-2-enylidene]amino]-1-cyano-N-(4-sulfamoylphenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide.
| Compound Name | 2-[[(E)-but-2-enylidene]amino]-1-cyano-N-(4-sulfamoylphenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
|---|---|
| PubChem CID | 5470028 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[[(E)-but-2-enylidene]amino]-1-cyano-N-(4-sulfamoylphenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
| SMILES | C/C=C/C=N/c1c(C#N)c2n(c1C(=O)Nc1ccc(S(N)(=O)=O)cc1)CCC2 |
| InChI | InChI=1S/C19H19N5O3S/c1-2-3-10-22-17-15(12-20)16-5-4-11-24(16)18(17)19(25)23-13-6-8-14(9-7-13)28(21,26)27/h2-3,6-10H,4-5,11H2,1H3,(H,23,25)(H2,21,26,27)/b3-2+,22-10+ |
| InChIKey | WOAQQAFZXZKOBG-KTWYXVPMSA-N |
| XLogP | 2.48 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|