C25H29F2N3O3 — CID 155554752
N-[[(3S,4S)-6,6-bis(4-fluorophenyl)-3-methoxy-3-methyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 155554752) has the molecular formula C25H29F2N3O3 and a molecular weight of 457.52 g/mol. Its IUPAC name is N-[[(3S,4S)-6,6-bis(4-fluorophenyl)-3-methoxy-3-methyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[[(3S,4S)-6,6-bis(4-fluorophenyl)-3-methoxy-3-methyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 155554752 |
| Molecular Formula | C25H29F2N3O3 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[[(3S,4S)-6,6-bis(4-fluorophenyl)-3-methoxy-3-methyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | CO[C@@]1(C)OOC(c2ccc(F)cc2)(c2ccc(F)cc2)C[C@H]1CNCCCn1ccnc1 |
| InChI | InChI=1S/C25H29F2N3O3/c1-24(31-2)21(17-28-12-3-14-30-15-13-29-18-30)16-25(33-32-24,19-4-8-22(26)9-5-19)20-6-10-23(27)11-7-20/h4-11,13,15,18,21,28H,3,12,14,16-17H2,1-2H3/t21-,24-/m0/s1 |
| InChIKey | BRRYYMYPBYGBMP-URXFXBBRSA-N |
| XLogP | 4.42 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|