C34H35N5O12 — CID 155557510
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl]oxymethyl]triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 155557510) has the molecular formula C34H35N5O12 and a molecular weight of 705.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl]oxymethyl]triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl]oxymethyl]triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155557510 |
| Molecular Formula | C34H35N5O12 |
| Molecular Weight | 705.68 g/mol |
| Exact Mass | 705.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl]oxymethyl]triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | COc1cccc(C2C(C#N)=C(N)Oc3cc(OCc4cn([C@@H]5O[C@H](COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)[C@H]5OC(C)=O)nn4)ccc32)c1 |
| InChI | InChI=1S/C34H35N5O12/c1-17(40)45-16-28-30(47-18(2)41)31(48-19(3)42)32(49-20(4)43)34(51-28)39-14-22(37-38-39)15-46-24-9-10-25-27(12-24)50-33(36)26(13-35)29(25)21-7-6-8-23(11-21)44-5/h6-12,14,28-32,34H,15-16,36H2,1-5H3/t28-,29?,30-,31?,32-,34-/m1/s1 |
| InChIKey | GPEDXHOIPRIISL-UTBNLSHLSA-N |
| XLogP | 2.34 |
| TPSA | 222.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.68 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|