C25H29NO5S2 — CID 155557926
2-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenoxy]ethyl pyrrolidine-1-carbodithioate (PubChem CID 155557926) has the molecular formula C25H29NO5S2 and a molecular weight of 487.64 g/mol. Its IUPAC name is 2-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenoxy]ethyl pyrrolidine-1-carbodithioate.
| Compound Name | 2-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenoxy]ethyl pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 155557926 |
| Molecular Formula | C25H29NO5S2 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 2-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenoxy]ethyl pyrrolidine-1-carbodithioate |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(OCCSC(=S)N3CCCC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H29NO5S2/c1-28-22-16-18(17-23(29-2)24(22)30-3)6-11-21(27)19-7-9-20(10-8-19)31-14-15-33-25(32)26-12-4-5-13-26/h6-11,16-17H,4-5,12-15H2,1-3H3/b11-6+ |
| InChIKey | UAPXBSVFPFTIQZ-IZZDOVSWSA-N |
| XLogP | 5.10 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|