C25H19N7S2 — CID 155559388
3-[[5-(1H-indol-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 155559388) has the molecular formula C25H19N7S2 and a molecular weight of 481.61 g/mol. Its IUPAC name is 3-[[5-(1H-indol-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[[5-(1H-indol-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 155559388 |
| Molecular Formula | C25H19N7S2 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 3-[[5-(1H-indol-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(CSc2nnc(-c3cc4ccccc4[nH]3)n2-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H19N7S2/c33-24-29-27-22(31(24)18-10-3-1-4-11-18)16-34-25-30-28-23(32(25)19-12-5-2-6-13-19)21-15-17-9-7-8-14-20(17)26-21/h1-15,26H,16H2,(H,29,33) |
| InChIKey | WPZYVQWMJJHRGS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|