C17H14N4S — CID 3287082
3-(1H-indol-3-ylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 3287082) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(1H-indol-3-ylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3287082 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-(1H-indol-3-ylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(Cc2c[nH]c3ccccc23)n1-c1ccccc1 |
| InChI | InChI=1S/C17H14N4S/c22-17-20-19-16(21(17)13-6-2-1-3-7-13)10-12-11-18-15-9-5-4-8-14(12)15/h1-9,11,18H,10H2,(H,20,22) |
| InChIKey | KWXJFDXNNYPOGY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|