C12H13N5S — CID 11108047
4-amino-3-[2-(1H-indol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 11108047) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is 4-amino-3-[2-(1H-indol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[2-(1H-indol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 11108047 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-amino-3-[2-(1H-indol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(CCc2c[nH]c3ccccc23)n[nH]c1=S |
| InChI | InChI=1S/C12H13N5S/c13-17-11(15-16-12(17)18)6-5-8-7-14-10-4-2-1-3-9(8)10/h1-4,7,14H,5-6,13H2,(H,16,18) |
| InChIKey | KAIXNQOLQNOBGA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|