C12H11N3OS — CID 86272987
5-[2-(1H-indol-3-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 86272987) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 5-[2-(1H-indol-3-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(1H-indol-3-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 86272987 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 5-[2-(1H-indol-3-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(CCc2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C12H11N3OS/c17-12-15-14-11(16-12)6-5-8-7-13-10-4-2-1-3-9(8)10/h1-4,7,13H,5-6H2,(H,15,17) |
| InChIKey | IMFCPXHJTCXXNW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|