C12H10N2O3 — CID 139312081
3-[2-(1H-indol-3-yl)ethyl]-1,4,2-dioxazol-5-one (PubChem CID 139312081) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-yl)ethyl]-1,4,2-dioxazol-5-one.
| Compound Name | 3-[2-(1H-indol-3-yl)ethyl]-1,4,2-dioxazol-5-one |
|---|---|
| PubChem CID | 139312081 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-[2-(1H-indol-3-yl)ethyl]-1,4,2-dioxazol-5-one |
| SMILES | O=c1onc(CCc2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C12H10N2O3/c15-12-16-11(14-17-12)6-5-8-7-13-10-4-2-1-3-9(8)10/h1-4,7,13H,5-6H2 |
| InChIKey | GGXOINGLSHBWEW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |