C24H21BrN2O2 — CID 155559476
1-(furan-2-yl)-6-methoxy-2-[(4-methylphenyl)methyl]-9H-pyrido[3,4-b]indol-2-ium bromide (PubChem CID 155559476) has the molecular formula C24H21BrN2O2 and a molecular weight of 449.35 g/mol. Its IUPAC name is 1-(furan-2-yl)-6-methoxy-2-[(4-methylphenyl)methyl]-9H-pyrido[3,4-b]indol-2-ium bromide.
| Compound Name | 1-(furan-2-yl)-6-methoxy-2-[(4-methylphenyl)methyl]-9H-pyrido[3,4-b]indol-2-ium bromide |
|---|---|
| PubChem CID | 155559476 |
| Molecular Formula | C24H21BrN2O2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 1-(furan-2-yl)-6-methoxy-2-[(4-methylphenyl)methyl]-9H-pyrido[3,4-b]indol-2-ium bromide |
| SMILES | COc1ccc2[nH]c3c(-c4ccco4)[n+](Cc4ccc(C)cc4)ccc3c2c1.[Br-] |
| InChI | InChI=1S/C24H20N2O2.BrH/c1-16-5-7-17(8-6-16)15-26-12-11-19-20-14-18(27-2)9-10-21(20)25-23(19)24(26)22-4-3-13-28-22;/h3-14H,15H2,1-2H3;1H |
| InChIKey | NXAQCKXWFCGRFV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 42.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|