C20H19N2O+ — CID 101358504
7-methoxy-16,17,18,19-tetrahydro-3H-yohimban-13-ium (PubChem CID 101358504) has the molecular formula C20H19N2O+ and a molecular weight of 303.39 g/mol. Its IUPAC name is 7-methoxy-16,17,18,19-tetrahydro-3H-yohimban-13-ium.
| Compound Name | 7-methoxy-16,17,18,19-tetrahydro-3H-yohimban-13-ium |
|---|---|
| PubChem CID | 101358504 |
| Molecular Formula | C20H19N2O+ |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 7-methoxy-16,17,18,19-tetrahydro-3H-yohimban-13-ium |
| SMILES | COc1ccc2[nH]c3c(cc[n+]4cc5c(cc34)CCCC5)c2c1 |
| InChI | InChI=1S/C20H18N2O/c1-23-15-6-7-18-17(11-15)16-8-9-22-12-14-5-3-2-4-13(14)10-19(22)20(16)21-18/h6-12H,2-5H2,1H3/p+1 |
| InChIKey | BFNULTKMINJXNG-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 29.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|