C20H21N2O+ — CID 10620094
2,3-diethyl-10-methoxy-12H-indolo[2,3-a]quinolizin-5-ium (PubChem CID 10620094) has the molecular formula C20H21N2O+ and a molecular weight of 305.40 g/mol. Its IUPAC name is 2,3-diethyl-10-methoxy-12H-indolo[2,3-a]quinolizin-5-ium.
| Compound Name | 2,3-diethyl-10-methoxy-12H-indolo[2,3-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 10620094 |
| Molecular Formula | C20H21N2O+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2,3-diethyl-10-methoxy-12H-indolo[2,3-a]quinolizin-5-ium |
| SMILES | CCc1cc2c3[nH]c4cc(OC)ccc4c3cc[n+]2cc1CC |
| InChI | InChI=1S/C20H20N2O/c1-4-13-10-19-20-17(8-9-22(19)12-14(13)5-2)16-7-6-15(23-3)11-18(16)21-20/h6-12H,4-5H2,1-3H3/p+1 |
| InChIKey | FEXLNLZEPXKEMU-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 29.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|