C15H15BN2O3 — CID 155560349
3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxymethyl]benzenecarboximidamide (PubChem CID 155560349) has the molecular formula C15H15BN2O3 and a molecular weight of 282.11 g/mol. Its IUPAC name is 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxymethyl]benzenecarboximidamide.
| Compound Name | 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxymethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 155560349 |
| Molecular Formula | C15H15BN2O3 |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxymethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(COc2ccc3c(c2)B(O)OC3)c1 |
| InChI | InChI=1S/C15H15BN2O3/c17-15(18)11-3-1-2-10(6-11)8-20-13-5-4-12-9-21-16(19)14(12)7-13/h1-7,19H,8-9H2,(H3,17,18) |
| InChIKey | XLRHQXGTXMESBN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|